C16H15BrN6O4 — CID 118961088
N-(6-bromo-2-pyridinyl)-2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide (PubChem CID 118961088) has the molecular formula C16H15BrN6O4 and a molecular weight of 435.24 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide |
|---|---|
| PubChem CID | 118961088 |
| Molecular Formula | C16H15BrN6O4 |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide |
| SMILES | CC(=O)Cn1c(=O)c2c(ncn2CC(=O)Nc2cccc(Br)n2)n(C)c1=O |
| InChI | InChI=1S/C16H15BrN6O4/c1-9(24)6-23-15(26)13-14(21(2)16(23)27)18-8-22(13)7-12(25)20-11-5-3-4-10(17)19-11/h3-5,8H,6-7H2,1-2H3,(H,19,20,25) |
| InChIKey | MCHXOTCLEYGWSU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|