C13H10FN3O3 — CID 118961550
2-[[3-(4-fluoroanilino)-4-pyridinyl]amino]-2-oxoacetic acid (PubChem CID 118961550) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is 2-[[3-(4-fluoroanilino)-4-pyridinyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[3-(4-fluoroanilino)-4-pyridinyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 118961550 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-[[3-(4-fluoroanilino)-4-pyridinyl]amino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1ccncc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H10FN3O3/c14-8-1-3-9(4-2-8)16-11-7-15-6-5-10(11)17-12(18)13(19)20/h1-7,16H,(H,19,20)(H,15,17,18) |
| InChIKey | DKXUKPGKBOETJR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|