C24H19FN4O2 — CID 86963890
N'-[5-(4-fluoroanilino)isoquinolin-8-yl]-N-(4-methylphenyl)oxamide (PubChem CID 86963890) has the molecular formula C24H19FN4O2 and a molecular weight of 414.44 g/mol. Its IUPAC name is N'-[5-(4-fluoroanilino)isoquinolin-8-yl]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[5-(4-fluoroanilino)isoquinolin-8-yl]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 86963890 |
| Molecular Formula | C24H19FN4O2 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N'-[5-(4-fluoroanilino)isoquinolin-8-yl]-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2ccc(Nc3ccc(F)cc3)c3ccncc23)cc1 |
| InChI | InChI=1S/C24H19FN4O2/c1-15-2-6-18(7-3-15)28-23(30)24(31)29-22-11-10-21(19-12-13-26-14-20(19)22)27-17-8-4-16(25)5-9-17/h2-14,27H,1H3,(H,28,30)(H,29,31) |
| InChIKey | HMFQDWYKNLTGKP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|