C21H18F3N5O2 — CID 118962040
2-(1-methylindol-5-yl)-N-[2-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide (PubChem CID 118962040) has the molecular formula C21H18F3N5O2 and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-(1-methylindol-5-yl)-N-[2-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide.
| Compound Name | 2-(1-methylindol-5-yl)-N-[2-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 118962040 |
| Molecular Formula | C21H18F3N5O2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-(1-methylindol-5-yl)-N-[2-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide |
| SMILES | Cn1ccc2cc(CC(=O)Nc3cnn(Cc4ccc(OC(F)(F)F)cc4)n3)ccc21 |
| InChI | InChI=1S/C21H18F3N5O2/c1-28-9-8-16-10-15(4-7-18(16)28)11-20(30)26-19-12-25-29(27-19)13-14-2-5-17(6-3-14)31-21(22,23)24/h2-10,12H,11,13H2,1H3,(H,26,27,30) |
| InChIKey | IEGGKWCXOIUSCU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |