C22H24F2N4O2 — CID 118962107
2-(4-tert-butylphenyl)-N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide (PubChem CID 118962107) has the molecular formula C22H24F2N4O2 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 118962107 |
| Molecular Formula | C22H24F2N4O2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]acetamide |
| SMILES | CC(C)(C)c1ccc(CC(=O)Nc2cnn(Cc3ccc(OC(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C22H24F2N4O2/c1-22(2,3)17-8-4-15(5-9-17)12-20(29)26-19-13-25-28(27-19)14-16-6-10-18(11-7-16)30-21(23)24/h4-11,13,21H,12,14H2,1-3H3,(H,26,27,29) |
| InChIKey | WRWIYMQAQZTQSQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |