C21H19F2N5O2 — CID 118962161
N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide (PubChem CID 118962161) has the molecular formula C21H19F2N5O2 and a molecular weight of 411.41 g/mol. Its IUPAC name is N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide.
| Compound Name | N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide |
|---|---|
| PubChem CID | 118962161 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[2-[[4-(difluoromethoxy)phenyl]methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide |
| SMILES | Cn1ccc2cc(CC(=O)Nc3cnn(Cc4ccc(OC(F)F)cc4)n3)ccc21 |
| InChI | InChI=1S/C21H19F2N5O2/c1-27-9-8-16-10-15(4-7-18(16)27)11-20(29)25-19-12-24-28(26-19)13-14-2-5-17(6-3-14)30-21(22)23/h2-10,12,21H,11,13H2,1H3,(H,25,26,29) |
| InChIKey | VYKXTHKNGBKMET-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |