C18H23F3N2O3 — CID 118963151
1-(oxan-2-yl)-3-[4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]pyrazole-4-carbaldehyde (PubChem CID 118963151) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-[4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]pyrazole-4-carbaldehyde.
| Compound Name | 1-(oxan-2-yl)-3-[4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 118963151 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-(oxan-2-yl)-3-[4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(C2CCCCO2)nc1C1=CCC(COCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H23F3N2O3/c19-18(20,21)12-25-11-13-4-6-14(7-5-13)17-15(10-24)9-23(22-17)16-3-1-2-8-26-16/h6,9-10,13,16H,1-5,7-8,11-12H2 |
| InChIKey | LMTMUBPWNGHYNS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|