C44H38N2 — CID 118964298
N'-[(1R)-2-methyl-1-phenylbutyl]-N-[1-(3-triphenylen-2-ylphenyl)ethylidene]benzenecarboximidamide (PubChem CID 118964298) has the molecular formula C44H38N2 and a molecular weight of 594.80 g/mol. Its IUPAC name is N'-[(1R)-2-methyl-1-phenylbutyl]-N-[1-(3-triphenylen-2-ylphenyl)ethylidene]benzenecarboximidamide.
| Compound Name | N'-[(1R)-2-methyl-1-phenylbutyl]-N-[1-(3-triphenylen-2-ylphenyl)ethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 118964298 |
| Molecular Formula | C44H38N2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | N'-[(1R)-2-methyl-1-phenylbutyl]-N-[1-(3-triphenylen-2-ylphenyl)ethylidene]benzenecarboximidamide |
| SMILES | CCC(C)[C@@H](/N=C(/N=C(\C)c1cccc(-c2ccc3c4ccccc4c4ccccc4c3c2)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H38N2/c1-4-30(2)43(32-16-7-5-8-17-32)46-44(33-18-9-6-10-19-33)45-31(3)34-20-15-21-35(28-34)36-26-27-41-39-24-12-11-22-37(39)38-23-13-14-25-40(38)42(41)29-36/h5-30,43H,4H2,1-3H3/b45-31+,46-44+/t30?,43-/m1/s1 |
| InChIKey | OWACRSCDIHDNES-YTVXYQIESA-N |
| XLogP | 11.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|