C29H22Br2N2S — CID 147325589
N'-(1-dibenzothiophen-4-ylethyl)-N-[1-(3,5-dibromophenyl)ethylidene]benzenecarboximidamide (PubChem CID 147325589) has the molecular formula C29H22Br2N2S and a molecular weight of 590.38 g/mol. Its IUPAC name is N'-(1-dibenzothiophen-4-ylethyl)-N-[1-(3,5-dibromophenyl)ethylidene]benzenecarboximidamide.
| Compound Name | N'-(1-dibenzothiophen-4-ylethyl)-N-[1-(3,5-dibromophenyl)ethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 147325589 |
| Molecular Formula | C29H22Br2N2S |
| Molecular Weight | 590.38 g/mol |
| Exact Mass | 587.99 |
| IUPAC Name | N'-(1-dibenzothiophen-4-ylethyl)-N-[1-(3,5-dibromophenyl)ethylidene]benzenecarboximidamide |
| SMILES | C/C(=N\C(=N/C(C)c1cccc2c1sc1ccccc12)c1ccccc1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C29H22Br2N2S/c1-18(21-15-22(30)17-23(31)16-21)32-29(20-9-4-3-5-10-20)33-19(2)24-12-8-13-26-25-11-6-7-14-27(25)34-28(24)26/h3-17,19H,1-2H3/b32-18+,33-29- |
| InChIKey | DAQQNXISWLVIOY-GGLGZYQXSA-N |
| XLogP | 9.60 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.38 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|