C34H27N3S2 — CID 163651163
N-[amino(phenyl)methylidene]-N'-(1-dibenzothiophen-4-ylethyl)-5a,9a-dihydrodibenzothiophene-4-carboximidamide (PubChem CID 163651163) has the molecular formula C34H27N3S2 and a molecular weight of 541.75 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-(1-dibenzothiophen-4-ylethyl)-5a,9a-dihydrodibenzothiophene-4-carboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-(1-dibenzothiophen-4-ylethyl)-5a,9a-dihydrodibenzothiophene-4-carboximidamide |
|---|---|
| PubChem CID | 163651163 |
| Molecular Formula | C34H27N3S2 |
| Molecular Weight | 541.75 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-(1-dibenzothiophen-4-ylethyl)-5a,9a-dihydrodibenzothiophene-4-carboximidamide |
| SMILES | CC(/N=C(\N=C(/N)c1ccccc1)c1cccc2c1SC1C=CC=CC21)c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C34H27N3S2/c1-21(23-15-9-16-26-24-13-5-7-19-29(24)38-31(23)26)36-34(37-33(35)22-11-3-2-4-12-22)28-18-10-17-27-25-14-6-8-20-30(25)39-32(27)28/h2-21,25,30H,1H3,(H2,35,36,37) |
| InChIKey | IMIYTIYYMGCNLL-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.75 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|