About 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide
1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide (PubChem CID 146330763) has the molecular formula C21H16ClN3S
and a molecular weight of 377.90 g/mol. Its IUPAC name is 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide.
Molecular Properties
| Compound Name | 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide |
| PubChem CID | 146330763 |
| Molecular Formula | C21H16ClN3S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide |
| SMILES | C/N=C(/N=C(\N)c1ccc(Cl)c2c1sc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN3S/c1-24-21(13-7-3-2-4-8-13)25-20(23)15-11-12-16(22)18-14-9-5-6-10-17(14)26-19(15)18/h2-12H,1H3,(H2,23,24,25) |
| InChIKey | VEUKZRIMDXAWKO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide?
The IUPAC name of 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide (CID 146330763) is 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide.
What is the SMILES notation for 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide?
The canonical SMILES for 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide is C/N=C(/N=C(\N)c1ccc(Cl)c2c1sc1ccccc12)c1ccccc1.
What is the InChIKey of 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide?
The InChIKey is VEUKZRIMDXAWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClN3S/c1-24-21(13-7-3-2-4-8-13)25-20(23)15-11-12-16(22)18-14-9-5-6-10-17(14)26-19(15)18/h2-12H,1H3,(H2,23,24,25).
What are the key properties of 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide?
1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide has a molecular weight of 377.90 g/mol, XLogP of 5.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide is sourced from PubChem (CID 146330763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).