C21H16ClN3S — CID 146330763
1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide (PubChem CID 146330763) has the molecular formula C21H16ClN3S and a molecular weight of 377.90 g/mol. Its IUPAC name is 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide.
| Compound Name | 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide |
|---|---|
| PubChem CID | 146330763 |
| Molecular Formula | C21H16ClN3S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-chloro-N'-(N-methyl-C-phenylcarbonimidoyl)dibenzothiophene-4-carboximidamide |
| SMILES | C/N=C(/N=C(\N)c1ccc(Cl)c2c1sc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN3S/c1-24-21(13-7-3-2-4-8-13)25-20(23)15-11-12-16(22)18-14-9-5-6-10-17(14)26-19(15)18/h2-12H,1H3,(H2,23,24,25) |
| InChIKey | VEUKZRIMDXAWKO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|