C22H20BrO4P — CID 118967608
1-(9-bromo-8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-4-methylphosphanylbutane-1,4-dione (PubChem CID 118967608) has the molecular formula C22H20BrO4P and a molecular weight of 459.28 g/mol. Its IUPAC name is 1-(9-bromo-8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-4-methylphosphanylbutane-1,4-dione.
| Compound Name | 1-(9-bromo-8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-4-methylphosphanylbutane-1,4-dione |
|---|---|
| PubChem CID | 118967608 |
| Molecular Formula | C22H20BrO4P |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 1-(9-bromo-8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-4-methylphosphanylbutane-1,4-dione |
| SMILES | CPC(=O)CCC(=O)c1ccc2c(c1)COc1cc3c(cc1-2)CCC(Br)C3=O |
| InChI | InChI=1S/C22H20BrO4P/c1-28-21(25)7-6-19(24)13-2-4-15-14(8-13)11-27-20-10-16-12(9-17(15)20)3-5-18(23)22(16)26/h2,4,8-10,18,28H,3,5-7,11H2,1H3 |
| InChIKey | RVGGBWKSBJSTFO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|