C57H49Br5O9 — CID 159003758
bis(9-bromo-3-(2-bromo-1-hydroxyethyl)-6,9,10,11-tetrahydronaphtho[7,6-c]chromen-8-one);3-(2-bromo-1-hydroxyethyl)-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one (PubChem CID 159003758) has the molecular formula C57H49Br5O9 and a molecular weight of 1277.53 g/mol. Its IUPAC name is bis(9-bromo-3-(2-bromo-1-hydroxyethyl)-6,9,10,11-tetrahydronaphtho[7,6-c]chromen-8-one);3-(2-bromo-1-hydroxyethyl)-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one.
| Compound Name | bis(9-bromo-3-(2-bromo-1-hydroxyethyl)-6,9,10,11-tetrahydronaphtho[7,6-c]chromen-8-one);3-(2-bromo-1-hydroxyethyl)-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one |
|---|---|
| PubChem CID | 159003758 |
| Molecular Formula | C57H49Br5O9 |
| Molecular Weight | 1277.53 g/mol |
| Exact Mass | 1271.93 |
| IUPAC Name | bis(9-bromo-3-(2-bromo-1-hydroxyethyl)-6,9,10,11-tetrahydronaphtho[7,6-c]chromen-8-one);3-(2-bromo-1-hydroxyethyl)-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one |
| SMILES | O=C1CCCc2cc3c(cc21)OCc1cc(C(O)CBr)ccc1-3.O=C1c2cc3c(cc2CCC1Br)-c1ccc(C(O)CBr)cc1OC3.O=C1c2cc3c(cc2CCC1Br)-c1ccc(C(O)CBr)cc1OC3 |
| InChI | InChI=1S/2C19H16Br2O3.C19H17BrO3/c2*20-8-17(22)11-1-3-13-14-5-10-2-4-16(21)19(23)15(10)6-12(14)9-24-18(13)7-11;20-9-18(22)12-4-5-14-13(6-12)10-23-19-8-15-11(7-16(14)19)2-1-3-17(15)21/h2*1,3,5-7,16-17,22H,2,4,8-9H2;4-8,18,22H,1-3,9-10H2 |
| InChIKey | JRQVZKMQWXUWOM-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1277.53 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|