C23H18O5S — CID 118573523
2-(8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)benzenesulfonic acid (PubChem CID 118573523) has the molecular formula C23H18O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-(8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)benzenesulfonic acid.
| Compound Name | 2-(8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 118573523 |
| Molecular Formula | C23H18O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-(8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)benzenesulfonic acid |
| SMILES | O=C1CCCc2cc3c(cc21)OCc1cc(-c2ccccc2S(=O)(=O)O)ccc1-3 |
| InChI | InChI=1S/C23H18O5S/c24-21-6-3-4-14-11-20-17-9-8-15(10-16(17)13-28-22(20)12-19(14)21)18-5-1-2-7-23(18)29(25,26)27/h1-2,5,7-12H,3-4,6,13H2,(H,25,26,27) |
| InChIKey | BOFOVUHAASIALG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|