C25H17F3O4 — CID 118573459
[4-(trifluoromethyl)phenyl] 8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromene-3-carboxylate (PubChem CID 118573459) has the molecular formula C25H17F3O4 and a molecular weight of 438.40 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromene-3-carboxylate.
| Compound Name | [4-(trifluoromethyl)phenyl] 8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromene-3-carboxylate |
|---|---|
| PubChem CID | 118573459 |
| Molecular Formula | C25H17F3O4 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromene-3-carboxylate |
| SMILES | O=C(Oc1ccc(C(F)(F)F)cc1)c1ccc2c(c1)COc1cc3c(cc1-2)CCCC3=O |
| InChI | InChI=1S/C25H17F3O4/c26-25(27,28)17-5-7-18(8-6-17)32-24(30)15-4-9-19-16(10-15)13-31-23-12-20-14(11-21(19)23)2-1-3-22(20)29/h4-12H,1-3,13H2 |
| InChIKey | MECFVABMZZPELC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|