C24H17F3O5S — CID 118573495
(8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl) 4-(trifluoromethyl)benzenesulfonate (PubChem CID 118573495) has the molecular formula C24H17F3O5S and a molecular weight of 474.46 g/mol. Its IUPAC name is (8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl) 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | (8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl) 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 118573495 |
| Molecular Formula | C24H17F3O5S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (8-oxo-5,9,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl) 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C1CCCc2cc3c(cc21)OCc1cc(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)ccc1-3 |
| InChI | InChI=1S/C24H17F3O5S/c25-24(26,27)16-4-7-18(8-5-16)33(29,30)32-17-6-9-19-15(10-17)13-31-23-12-20-14(11-21(19)23)2-1-3-22(20)28/h4-12H,1-3,13H2 |
| InChIKey | IZAVVLTWXMCMEB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|