C30H27F3O4S — CID 44888352
2-tert-butyl-4,9-diphenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate (PubChem CID 44888352) has the molecular formula C30H27F3O4S and a molecular weight of 540.60 g/mol. Its IUPAC name is 2-tert-butyl-4,9-diphenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate.
| Compound Name | 2-tert-butyl-4,9-diphenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888352 |
| Molecular Formula | C30H27F3O4S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 2-tert-butyl-4,9-diphenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c2c([o+]1)-c1cc(-c3ccccc3)ccc1CC2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C29H27O.CHF3O3S/c1-29(2,3)27-19-25(21-12-8-5-9-13-21)24-17-16-22-14-15-23(18-26(22)28(24)30-27)20-10-6-4-7-11-20;2-1(3,4)8(5,6)7/h4-15,18-19H,16-17H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | HQDULSZZPJXHSC-UHFFFAOYSA-M |
| XLogP | 8.01 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|