C30H31F3O4S — CID 10370173
2,6-ditert-butyl-4-[4-(trifluoromethyl)phenyl]pyrylium;naphthalene-2-sulfonate (PubChem CID 10370173) has the molecular formula C30H31F3O4S and a molecular weight of 544.64 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[4-(trifluoromethyl)phenyl]pyrylium;naphthalene-2-sulfonate.
| Compound Name | 2,6-ditert-butyl-4-[4-(trifluoromethyl)phenyl]pyrylium;naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 10370173 |
| Molecular Formula | C30H31F3O4S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2,6-ditert-butyl-4-[4-(trifluoromethyl)phenyl]pyrylium;naphthalene-2-sulfonate |
| SMILES | CC(C)(C)c1cc(-c2ccc(C(F)(F)F)cc2)cc(C(C)(C)C)[o+]1.O=S(=O)([O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24F3O.C10H8O3S/c1-18(2,3)16-11-14(12-17(24-16)19(4,5)6)13-7-9-15(10-8-13)20(21,22)23;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h7-12H,1-6H3;1-7H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | VMAFENHSAARQCG-UHFFFAOYSA-M |
| XLogP | 8.59 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|