C26H25F3O4S — CID 44888220
11,11-dimethyl-7-phenyl-6,8,9,10-tetrahydro-5H-benzo[c]xanthen-12-ium;trifluoromethanesulfonate (PubChem CID 44888220) has the molecular formula C26H25F3O4S and a molecular weight of 490.54 g/mol. Its IUPAC name is 11,11-dimethyl-7-phenyl-6,8,9,10-tetrahydro-5H-benzo[c]xanthen-12-ium;trifluoromethanesulfonate.
| Compound Name | 11,11-dimethyl-7-phenyl-6,8,9,10-tetrahydro-5H-benzo[c]xanthen-12-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888220 |
| Molecular Formula | C26H25F3O4S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 11,11-dimethyl-7-phenyl-6,8,9,10-tetrahydro-5H-benzo[c]xanthen-12-ium;trifluoromethanesulfonate |
| SMILES | CC1(C)CCCc2c1[o+]c1c(c2-c2ccccc2)CCc2ccccc2-1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H25O.CHF3O3S/c1-25(2)16-8-13-21-22(18-10-4-3-5-11-18)20-15-14-17-9-6-7-12-19(17)23(20)26-24(21)25;2-1(3,4)8(5,6)7/h3-7,9-12H,8,13-16H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KRJZFPNMGGBIHH-UHFFFAOYSA-M |
| XLogP | 6.66 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|