C25H25F3O4S — CID 134909655
2-tert-butyl-3-methyl-4-phenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate (PubChem CID 134909655) has the molecular formula C25H25F3O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-tert-butyl-3-methyl-4-phenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate.
| Compound Name | 2-tert-butyl-3-methyl-4-phenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134909655 |
| Molecular Formula | C25H25F3O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-tert-butyl-3-methyl-4-phenyl-5,6-dihydrobenzo[h]chromen-1-ium;trifluoromethanesulfonate |
| SMILES | Cc1c(C(C)(C)C)[o+]c2c(c1-c1ccccc1)CCc1ccccc1-2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H25O.CHF3O3S/c1-16-21(18-11-6-5-7-12-18)20-15-14-17-10-8-9-13-19(17)22(20)25-23(16)24(2,3)4;2-1(3,4)8(5,6)7/h5-13H,14-15H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | RJNWERAPBDFNJU-UHFFFAOYSA-M |
| XLogP | 6.65 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|