C21H32N2O2+2 — CID 11897053
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 11897053) has the molecular formula C21H32N2O2+2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 11897053 |
| Molecular Formula | C21H32N2O2+2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | COc1cccc(C[NH+]2CC[NH+](C[C@@H]3C[C@@H]4C=C[C@H]3C4)CC2)c1OC |
| InChI | InChI=1S/C21H30N2O2/c1-24-20-5-3-4-18(21(20)25-2)14-22-8-10-23(11-9-22)15-19-13-16-6-7-17(19)12-16/h3-7,16-17,19H,8-15H2,1-2H3/p+2/t16-,17+,19+/m1/s1 |
| InChIKey | VJLNIMQTDUUJFE-AOIWGVFYSA-P |
| XLogP | 0.20 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|