C19H27BrN2O+2 — CID 11899368
2-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1,4-diium-1-yl]methyl]-4-bromophenol (PubChem CID 11899368) has the molecular formula C19H27BrN2O+2 and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1,4-diium-1-yl]methyl]-4-bromophenol.
| Compound Name | 2-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1,4-diium-1-yl]methyl]-4-bromophenol |
|---|---|
| PubChem CID | 11899368 |
| Molecular Formula | C19H27BrN2O+2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1,4-diium-1-yl]methyl]-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1C[NH+]1CC[NH+](C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H25BrN2O/c20-18-3-4-19(23)17(11-18)13-22-7-5-21(6-8-22)12-16-10-14-1-2-15(16)9-14/h1-4,11,14-16,23H,5-10,12-13H2/p+2/t14-,15+,16+/m1/s1 |
| InChIKey | YNTXNYUEXYOHDS-PMPSAXMXSA-P |
| XLogP | 0.65 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|