C18H25N2+ — CID 11917664
1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-phenylpiperazin-1-ium (PubChem CID 11917664) has the molecular formula C18H25N2+ and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 11917664 |
| Molecular Formula | C18H25N2+ |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-phenylpiperazin-1-ium |
| SMILES | C1=C[C@H]2C[C@@H]1C[C@@H]2C[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N2/c1-2-4-18(5-3-1)20-10-8-19(9-11-20)14-17-13-15-6-7-16(17)12-15/h1-7,15-17H,8-14H2/p+1/t15-,16+,17-/m1/s1 |
| InChIKey | XHLIVZUGWXPOEE-IXDOHACOSA-O |
| XLogP | 1.60 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|