C15H27N2O2S+ — CID 6593196
1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazin-1-ium (PubChem CID 6593196) has the molecular formula C15H27N2O2S+ and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazin-1-ium.
| Compound Name | 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 6593196 |
| Molecular Formula | C15H27N2O2S+ |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazin-1-ium |
| SMILES | CCCS(=O)(=O)N1CC[NH+](C[C@H]2C[C@@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C15H26N2O2S/c1-2-9-20(18,19)17-7-5-16(6-8-17)12-15-11-13-3-4-14(15)10-13/h3-4,13-15H,2,5-12H2,1H3/p+1/t13-,14+,15-/m1/s1 |
| InChIKey | CYXYNMSOFRFXOP-QLFBSQMISA-O |
| XLogP | 0.14 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|