C18H29BrN2O2+2 — CID 6980727
4-bromo-2-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]piperidin-1-ium-1-yl]methyl]phenol (PubChem CID 6980727) has the molecular formula C18H29BrN2O2+2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-bromo-2-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]piperidin-1-ium-1-yl]methyl]phenol.
| Compound Name | 4-bromo-2-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]piperidin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 6980727 |
| Molecular Formula | C18H29BrN2O2+2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-bromo-2-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]piperidin-1-ium-1-yl]methyl]phenol |
| SMILES | C[C@@H]1C[NH+](C2CC[NH+](Cc3cc(Br)ccc3O)CC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H27BrN2O2/c1-13-10-21(11-14(2)23-13)17-5-7-20(8-6-17)12-15-9-16(19)3-4-18(15)22/h3-4,9,13-14,17,22H,5-8,10-12H2,1-2H3/p+2/t13-,14-/m1/s1 |
| InChIKey | JSYFTNHIHRBLSW-ZIAGYGMSSA-P |
| XLogP | 0.39 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|