C18H31BrN3O2+3 — CID 6980631
4-bromo-2-[[4-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]piperidin-1-ium-1-yl]methyl]phenol (PubChem CID 6980631) has the molecular formula C18H31BrN3O2+3 and a molecular weight of 401.37 g/mol. Its IUPAC name is 4-bromo-2-[[4-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]piperidin-1-ium-1-yl]methyl]phenol.
| Compound Name | 4-bromo-2-[[4-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]piperidin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 6980631 |
| Molecular Formula | C18H31BrN3O2+3 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-bromo-2-[[4-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]piperidin-1-ium-1-yl]methyl]phenol |
| SMILES | OCC[NH+]1CC[NH+](C2CC[NH+](Cc3cc(Br)ccc3O)CC2)CC1 |
| InChI | InChI=1S/C18H28BrN3O2/c19-16-1-2-18(24)15(13-16)14-21-5-3-17(4-6-21)22-9-7-20(8-10-22)11-12-23/h1-2,13,17,23-24H,3-12,14H2/p+3 |
| InChIKey | ZZBFQHZBZKUMCJ-UHFFFAOYSA-Q |
| XLogP | -2.52 |
| TPSA | 53.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|