C20H29BrN2O+2 — CID 11861509
1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3-bromo-4-methoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 11861509) has the molecular formula C20H29BrN2O+2 and a molecular weight of 393.37 g/mol. Its IUPAC name is 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3-bromo-4-methoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3-bromo-4-methoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 11861509 |
| Molecular Formula | C20H29BrN2O+2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3-bromo-4-methoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | COc1ccc(C[NH+]2CC[NH+](C[C@H]3C[C@@H]4C=C[C@H]3C4)CC2)cc1Br |
| InChI | InChI=1S/C20H27BrN2O/c1-24-20-5-3-16(12-19(20)21)13-22-6-8-23(9-7-22)14-18-11-15-2-4-17(18)10-15/h2-5,12,15,17-18H,6-11,13-14H2,1H3/p+2/t15-,17+,18-/m1/s1 |
| InChIKey | YYBQGKNCXLPPSM-BPQIPLTHSA-P |
| XLogP | 0.95 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|