C20H28N3O3+ — CID 11898910
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(2-methoxy-5-nitrophenyl)piperidin-1-ium-4-amine (PubChem CID 11898910) has the molecular formula C20H28N3O3+ and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(2-methoxy-5-nitrophenyl)piperidin-1-ium-4-amine.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(2-methoxy-5-nitrophenyl)piperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 11898910 |
| Molecular Formula | C20H28N3O3+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(2-methoxy-5-nitrophenyl)piperidin-1-ium-4-amine |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC1CC[NH+](C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C20H27N3O3/c1-26-20-5-4-18(23(24)25)12-19(20)21-17-6-8-22(9-7-17)13-16-11-14-2-3-15(16)10-14/h2-5,12,14-17,21H,6-11,13H2,1H3/p+1/t14-,15+,16+/m1/s1 |
| InChIKey | UEORSABWIKKTGT-PMPSAXMXSA-O |
| XLogP | 2.27 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|