C19H17F3NO3- — CID 11897356
(1R,2S,3R,4S)-7-propan-2-ylidene-3-[[3-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11897356) has the molecular formula C19H17F3NO3- and a molecular weight of 364.34 g/mol. Its IUPAC name is (1R,2S,3R,4S)-7-propan-2-ylidene-3-[[3-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-7-propan-2-ylidene-3-[[3-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11897356 |
| Molecular Formula | C19H17F3NO3- |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (1R,2S,3R,4S)-7-propan-2-ylidene-3-[[3-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)=C1[C@H]2C=C[C@@H]1[C@H](C(=O)[O-])[C@@H]2C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3NO3/c1-9(2)14-12-6-7-13(14)16(18(25)26)15(12)17(24)23-11-5-3-4-10(8-11)19(20,21)22/h3-8,12-13,15-16H,1-2H3,(H,23,24)(H,25,26)/p-1/t12-,13+,15-,16+/m1/s1 |
| InChIKey | KNOYMEAZPBUJMH-CLWVCHIJSA-M |
| XLogP | 2.78 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|