C12H30N4 — CID 118974907
2-N-[[amino(ethyl)amino]methyl]-4-N-ethyl-4-N-methylhexane-2,4-diamine (PubChem CID 118974907) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-N-[[amino(ethyl)amino]methyl]-4-N-ethyl-4-N-methylhexane-2,4-diamine.
| Compound Name | 2-N-[[amino(ethyl)amino]methyl]-4-N-ethyl-4-N-methylhexane-2,4-diamine |
|---|---|
| PubChem CID | 118974907 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | 2-N-[[amino(ethyl)amino]methyl]-4-N-ethyl-4-N-methylhexane-2,4-diamine |
| SMILES | CCC(CC(C)NCN(N)CC)N(C)CC |
| InChI | InChI=1S/C12H30N4/c1-6-12(15(5)7-2)9-11(4)14-10-16(13)8-3/h11-12,14H,6-10,13H2,1-5H3 |
| InChIKey | RQBKROJVZYMIMQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|