C18H16F2N2O2 — CID 118976184
methyl (3Z)-3-(benzhydrylidenehydrazinylidene)-4,4-difluorobutanoate (PubChem CID 118976184) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is methyl (3Z)-3-(benzhydrylidenehydrazinylidene)-4,4-difluorobutanoate.
| Compound Name | methyl (3Z)-3-(benzhydrylidenehydrazinylidene)-4,4-difluorobutanoate |
|---|---|
| PubChem CID | 118976184 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl (3Z)-3-(benzhydrylidenehydrazinylidene)-4,4-difluorobutanoate |
| SMILES | COC(=O)C/C(=N/N=C(c1ccccc1)c1ccccc1)C(F)F |
| InChI | InChI=1S/C18H16F2N2O2/c1-24-16(23)12-15(18(19)20)21-22-17(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,18H,12H2,1H3/b21-15- |
| InChIKey | LWOBEXRZSJFPHV-QNGOZBTKSA-N |
| XLogP | 3.71 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|