C18H17N5OS — CID 11897993
2-[[4-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]phthalazin-1-one (PubChem CID 11897993) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-[[4-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]phthalazin-1-one.
| Compound Name | 2-[[4-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 11897993 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[[4-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1Cc1n[nH]c(=S)n1[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H17N5OS/c24-17-14-4-2-1-3-13(14)9-19-22(17)10-16-20-21-18(25)23(16)15-8-11-5-6-12(15)7-11/h1-6,9,11-12,15H,7-8,10H2,(H,21,25)/t11-,12+,15-/m1/s1 |
| InChIKey | VJLNIPBZTXRVDF-TYNCELHUSA-N |
| XLogP | 2.84 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|