C19H17N5O3S — CID 4871208
7,8-dimethoxy-2-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]phthalazin-1-one (PubChem CID 4871208) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is 7,8-dimethoxy-2-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]phthalazin-1-one.
| Compound Name | 7,8-dimethoxy-2-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 4871208 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 7,8-dimethoxy-2-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]phthalazin-1-one |
| SMILES | COc1ccc2cnn(Cc3n[nH]c(=S)n3-c3ccccc3)c(=O)c2c1OC |
| InChI | InChI=1S/C19H17N5O3S/c1-26-14-9-8-12-10-20-23(18(25)16(12)17(14)27-2)11-15-21-22-19(28)24(15)13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,22,28) |
| InChIKey | QTFBWSPYZMFFSY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|