C19H15N5O3S — CID 5304580
2-[2-[4-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one (PubChem CID 5304580) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is 2-[2-[4-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-[2-[4-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 5304580 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[2-[4-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1CCc1n[nH]c(=S)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15N5O3S/c25-18-14-4-2-1-3-12(14)10-20-23(18)8-7-17-21-22-19(28)24(17)13-5-6-15-16(9-13)27-11-26-15/h1-6,9-10H,7-8,11H2,(H,22,28) |
| InChIKey | AXZCZHQIIYFIGI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|