C17H16N4O3 — CID 50975593
3-(2-anilinoethyl)-4-(1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-5-one (PubChem CID 50975593) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-(2-anilinoethyl)-4-(1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2-anilinoethyl)-4-(1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 50975593 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-(2-anilinoethyl)-4-(1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CCNc2ccccc2)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N4O3/c22-17-20-19-16(8-9-18-12-4-2-1-3-5-12)21(17)13-6-7-14-15(10-13)24-11-23-14/h1-7,10,18H,8-9,11H2,(H,20,22) |
| InChIKey | NSDLPOJUIHBPST-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |