C28H22N2O3S2 — CID 118984777
N-[1-cyano-2,2-bis[(3-methoxyphenyl)sulfanyl]ethenyl]naphthalene-1-carboxamide (PubChem CID 118984777) has the molecular formula C28H22N2O3S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[1-cyano-2,2-bis[(3-methoxyphenyl)sulfanyl]ethenyl]naphthalene-1-carboxamide.
| Compound Name | N-[1-cyano-2,2-bis[(3-methoxyphenyl)sulfanyl]ethenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 118984777 |
| Molecular Formula | C28H22N2O3S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-[1-cyano-2,2-bis[(3-methoxyphenyl)sulfanyl]ethenyl]naphthalene-1-carboxamide |
| SMILES | COc1cccc(SC(Sc2cccc(OC)c2)=C(C#N)NC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C28H22N2O3S2/c1-32-20-10-6-12-22(16-20)34-28(35-23-13-7-11-21(17-23)33-2)26(18-29)30-27(31)25-15-5-9-19-8-3-4-14-24(19)25/h3-17H,1-2H3,(H,30,31) |
| InChIKey | WUNDEXXNEJENSK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|