C17H17N5OS — CID 118985021
2-[4-(2,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-N-phenylacetamide (PubChem CID 118985021) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-(2,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 118985021 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(C)c(-n2nnn(CC(=O)Nc3ccccc3)c2=S)c1 |
| InChI | InChI=1S/C17H17N5OS/c1-12-8-9-13(2)15(10-12)22-17(24)21(19-20-22)11-16(23)18-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,18,23) |
| InChIKey | NJMPEMCBWWXONQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|