C19H28N2O3 — CID 118987541
2-[1-hydroxy-3-(3-methoxyphenyl)propyl]-6-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 118987541) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[1-hydroxy-3-(3-methoxyphenyl)propyl]-6-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 2-[1-hydroxy-3-(3-methoxyphenyl)propyl]-6-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 118987541 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[1-hydroxy-3-(3-methoxyphenyl)propyl]-6-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | COc1cccc(CCC(O)C2NC(=O)C3CC(C)CCC3N2)c1 |
| InChI | InChI=1S/C19H28N2O3/c1-12-6-8-16-15(10-12)19(23)21-18(20-16)17(22)9-7-13-4-3-5-14(11-13)24-2/h3-5,11-12,15-18,20,22H,6-10H2,1-2H3,(H,21,23) |
| InChIKey | SPCCHNUDKMFUON-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |