C22H30ClN3O2 — CID 118987615
N-[[4-chloro-3-(7-cyclopropyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)phenyl]methyl]-2-methylpropanamide (PubChem CID 118987615) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is N-[[4-chloro-3-(7-cyclopropyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[4-chloro-3-(7-cyclopropyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 118987615 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[[4-chloro-3-(7-cyclopropyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)phenyl]methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCc1ccc(Cl)c(C2NC(=O)C3CCC(C4CC4)CC3N2)c1 |
| InChI | InChI=1S/C22H30ClN3O2/c1-12(2)21(27)24-11-13-3-8-18(23)17(9-13)20-25-19-10-15(14-4-5-14)6-7-16(19)22(28)26-20/h3,8-9,12,14-16,19-20,25H,4-7,10-11H2,1-2H3,(H,24,27)(H,26,28) |
| InChIKey | YODNBEASWAJJQX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |