C25H28ClF3N4O2 — CID 122363074
N-[[4-chloro-3-[4-oxo-7-[4-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide (PubChem CID 122363074) has the molecular formula C25H28ClF3N4O2 and a molecular weight of 508.97 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-oxo-7-[4-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-oxo-7-[4-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 122363074 |
| Molecular Formula | C25H28ClF3N4O2 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-[[4-chloro-3-[4-oxo-7-[4-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCc1ccc(Cl)c(C2NC(=O)C3CCC(c4ccc(C(F)(F)F)cc4)NC3N2)c1 |
| InChI | InChI=1S/C25H28ClF3N4O2/c1-13(2)23(34)30-12-14-3-9-19(26)18(11-14)22-32-21-17(24(35)33-22)8-10-20(31-21)15-4-6-16(7-5-15)25(27,28)29/h3-7,9,11,13,17,20-22,31-32H,8,10,12H2,1-2H3,(H,30,34)(H,33,35) |
| InChIKey | ATFGOQAAQYEPOC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |