C21H24NO2+ — CID 118987991
2-[3-[(3-methoxyphenoxy)methyl]phenyl]prop-2-enyl-methyl-prop-2-ynylazanium (PubChem CID 118987991) has the molecular formula C21H24NO2+ and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-[3-[(3-methoxyphenoxy)methyl]phenyl]prop-2-enyl-methyl-prop-2-ynylazanium.
| Compound Name | 2-[3-[(3-methoxyphenoxy)methyl]phenyl]prop-2-enyl-methyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 118987991 |
| Molecular Formula | C21H24NO2+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[3-[(3-methoxyphenoxy)methyl]phenyl]prop-2-enyl-methyl-prop-2-ynylazanium |
| SMILES | C#CC[NH+](C)CC(=C)c1cccc(COc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C21H23NO2/c1-5-12-22(3)15-17(2)19-9-6-8-18(13-19)16-24-21-11-7-10-20(14-21)23-4/h1,6-11,13-14H,2,12,15-16H2,3-4H3/p+1 |
| InChIKey | JXVBZFIJKSSFJJ-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|