C23H23NO4 — CID 11898967
(1S,1aS,7bR)-1-(2,2-dimethylpropanoyl)-N-(4-methylphenyl)-2-oxo-1,7b-dihydrocyclopropa[c]chromene-1a-carboxamide (PubChem CID 11898967) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (1S,1aS,7bR)-1-(2,2-dimethylpropanoyl)-N-(4-methylphenyl)-2-oxo-1,7b-dihydrocyclopropa[c]chromene-1a-carboxamide.
| Compound Name | (1S,1aS,7bR)-1-(2,2-dimethylpropanoyl)-N-(4-methylphenyl)-2-oxo-1,7b-dihydrocyclopropa[c]chromene-1a-carboxamide |
|---|---|
| PubChem CID | 11898967 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (1S,1aS,7bR)-1-(2,2-dimethylpropanoyl)-N-(4-methylphenyl)-2-oxo-1,7b-dihydrocyclopropa[c]chromene-1a-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@]23C(=O)Oc4ccccc4[C@H]2[C@@H]3C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-13-9-11-14(12-10-13)24-20(26)23-17(18(23)19(25)22(2,3)4)15-7-5-6-8-16(15)28-21(23)27/h5-12,17-18H,1-4H3,(H,24,26)/t17-,18+,23-/m0/s1 |
| InChIKey | RICYKHWFWHJOBY-IXFSTUDKSA-N |
| XLogP | 3.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|