C21H19N2O3P — CID 100976540
1-(4-methylphenyl)-3-[(2R,3R)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-yl]urea (PubChem CID 100976540) has the molecular formula C21H19N2O3P and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(2R,3R)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-yl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[(2R,3R)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-yl]urea |
|---|---|
| PubChem CID | 100976540 |
| Molecular Formula | C21H19N2O3P |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(2R,3R)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-yl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@H]2c3ccccc3O[P@]2(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N2O3P/c1-15-11-13-16(14-12-15)22-21(24)23-20-18-9-5-6-10-19(18)26-27(20,25)17-7-3-2-4-8-17/h2-14,20H,1H3,(H2,22,23,24)/t20-,27-/m1/s1 |
| InChIKey | AXLROKRNJHOKJZ-NFQMXDRXSA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|