C8H5FI2O3 — CID 118991913
2-(4-fluoro-2,5-diiodophenyl)-2-hydroxyacetic acid (PubChem CID 118991913) has the molecular formula C8H5FI2O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-(4-fluoro-2,5-diiodophenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(4-fluoro-2,5-diiodophenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118991913 |
| Molecular Formula | C8H5FI2O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.83 |
| IUPAC Name | 2-(4-fluoro-2,5-diiodophenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(I)c(F)cc1I |
| InChI | InChI=1S/C8H5FI2O3/c9-4-2-5(10)3(1-6(4)11)7(12)8(13)14/h1-2,7,12H,(H,13,14) |
| InChIKey | YPCPBYBQARTDMZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|