About 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one
4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 118992785) has the molecular formula C7H7BrN2O
and a molecular weight of 215.05 g/mol. Its IUPAC name is 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
Analyze 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one?
The IUPAC name of 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (CID 118992785) is 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
What is the SMILES notation for 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one?
The canonical SMILES for 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one is O=c1[nH]nc2c(c1Br)CCC2.
What is the InChIKey of 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one?
The InChIKey is RIAWNBUYYDFDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O/c8-6-4-2-1-3-5(4)9-10-7(6)11/h1-3H2,(H,10,11).
What are the key properties of 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one?
4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one has a molecular weight of 215.05 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one is sourced from PubChem (CID 118992785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).