C8H8BrFN2O — CID 171493606
7-bromo-4-(fluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171493606) has the molecular formula C8H8BrFN2O and a molecular weight of 247.07 g/mol. Its IUPAC name is 7-bromo-4-(fluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 7-bromo-4-(fluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171493606 |
| Molecular Formula | C8H8BrFN2O |
| Molecular Weight | 247.07 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 7-bromo-4-(fluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | O=c1[nH]nc2c(c1CF)CCC2Br |
| InChI | InChI=1S/C8H8BrFN2O/c9-6-2-1-4-5(3-10)8(13)12-11-7(4)6/h6H,1-3H2,(H,12,13) |
| InChIKey | CXVRKLVYONGJKM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.07 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|