C9H12BrF3N2O — CID 171493146
3-(bromomethyl)-4-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one;ethane (PubChem CID 171493146) has the molecular formula C9H12BrF3N2O and a molecular weight of 301.11 g/mol. Its IUPAC name is 3-(bromomethyl)-4-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one;ethane.
| Compound Name | 3-(bromomethyl)-4-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one;ethane |
|---|---|
| PubChem CID | 171493146 |
| Molecular Formula | C9H12BrF3N2O |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-(bromomethyl)-4-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one;ethane |
| SMILES | CC.Cc1c(CBr)n[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C7H6BrF3N2O.C2H6/c1-3-4(2-8)12-13-6(14)5(3)7(9,10)11;1-2/h2H2,1H3,(H,13,14);1-2H3 |
| InChIKey | CSBAADSGUZVLBJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|