C9H10BrFN2O — CID 171492747
7-bromo-4-(1-fluoroethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171492747) has the molecular formula C9H10BrFN2O and a molecular weight of 261.09 g/mol. Its IUPAC name is 7-bromo-4-(1-fluoroethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 7-bromo-4-(1-fluoroethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171492747 |
| Molecular Formula | C9H10BrFN2O |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 7-bromo-4-(1-fluoroethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | CC(F)c1c2c(n[nH]c1=O)C(Br)CC2 |
| InChI | InChI=1S/C9H10BrFN2O/c1-4(11)7-5-2-3-6(10)8(5)12-13-9(7)14/h4,6H,2-3H2,1H3,(H,13,14) |
| InChIKey | QITJFDJBIYTUHM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|