C12H9BrF6N4O2 — CID 160729688
3-(bromomethyl)-5-(trifluoromethyl)-1H-pyridazin-6-one;3-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 160729688) has the molecular formula C12H9BrF6N4O2 and a molecular weight of 435.12 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(trifluoromethyl)-1H-pyridazin-6-one;3-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 3-(bromomethyl)-5-(trifluoromethyl)-1H-pyridazin-6-one;3-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 160729688 |
| Molecular Formula | C12H9BrF6N4O2 |
| Molecular Weight | 435.12 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 3-(bromomethyl)-5-(trifluoromethyl)-1H-pyridazin-6-one;3-methyl-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | Cc1cc(C(F)(F)F)c(=O)[nH]n1.O=c1[nH]nc(CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C6H4BrF3N2O.C6H5F3N2O/c7-2-3-1-4(6(8,9)10)5(13)12-11-3;1-3-2-4(6(7,8)9)5(12)11-10-3/h1H,2H2,(H,12,13);2H,1H3,(H,11,12) |
| InChIKey | RUEBQVKUXQUOOS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|