C10H11BrN4O2 — CID 158081158
3-(bromomethyl)-1H-pyridazin-6-one;3-methyl-1H-pyridazin-6-one (PubChem CID 158081158) has the molecular formula C10H11BrN4O2 and a molecular weight of 299.13 g/mol. Its IUPAC name is 3-(bromomethyl)-1H-pyridazin-6-one;3-methyl-1H-pyridazin-6-one.
| Compound Name | 3-(bromomethyl)-1H-pyridazin-6-one;3-methyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 158081158 |
| Molecular Formula | C10H11BrN4O2 |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 3-(bromomethyl)-1H-pyridazin-6-one;3-methyl-1H-pyridazin-6-one |
| SMILES | Cc1ccc(=O)[nH]n1.O=c1ccc(CBr)n[nH]1 |
| InChI | InChI=1S/C5H5BrN2O.C5H6N2O/c6-3-4-1-2-5(9)8-7-4;1-4-2-3-5(8)7-6-4/h1-2H,3H2,(H,8,9);2-3H,1H3,(H,7,8) |
| InChIKey | FMYVWCQPFYRVSM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|